C16H18FNO4 — CID 119212059
2-[(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]-3-methylpentanoic acid (PubChem CID 119212059) has the molecular formula C16H18FNO4 and a molecular weight of 307.32 g/mol. Its IUPAC name is 2-[(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]-3-methylpentanoic acid.
| Compound Name | 2-[(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 119212059 |
| Molecular Formula | C16H18FNO4 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-[(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)c1oc2ccc(F)cc2c1C)C(=O)O |
| InChI | InChI=1S/C16H18FNO4/c1-4-8(2)13(16(20)21)18-15(19)14-9(3)11-7-10(17)5-6-12(11)22-14/h5-8,13H,4H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | ZOQKZRPBMJKYEL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |