C15H17FN2O3 — CID 17441780
5-fluoro-3-methyl-N'-(3-methylbutanoyl)-1-benzofuran-2-carbohydrazide (PubChem CID 17441780) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is 5-fluoro-3-methyl-N'-(3-methylbutanoyl)-1-benzofuran-2-carbohydrazide.
| Compound Name | 5-fluoro-3-methyl-N'-(3-methylbutanoyl)-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 17441780 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 5-fluoro-3-methyl-N'-(3-methylbutanoyl)-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)CC(C)C)oc2ccc(F)cc12 |
| InChI | InChI=1S/C15H17FN2O3/c1-8(2)6-13(19)17-18-15(20)14-9(3)11-7-10(16)4-5-12(11)21-14/h4-5,7-8H,6H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | UFUGCYLUKVHTSG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|