C12H14F2N2O2 — CID 43017989
2,4-difluoro-N'-(3-methylbutanoyl)benzohydrazide (PubChem CID 43017989) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is 2,4-difluoro-N'-(3-methylbutanoyl)benzohydrazide.
| Compound Name | 2,4-difluoro-N'-(3-methylbutanoyl)benzohydrazide |
|---|---|
| PubChem CID | 43017989 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2,4-difluoro-N'-(3-methylbutanoyl)benzohydrazide |
| SMILES | CC(C)CC(=O)NNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H14F2N2O2/c1-7(2)5-11(17)15-16-12(18)9-4-3-8(13)6-10(9)14/h3-4,6-7H,5H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | WTOYBCDKBFLHEF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|