C19H14F2N2O2 — CID 42386169
2,4-difluoro-N'-(2-naphthalen-1-ylacetyl)benzohydrazide (PubChem CID 42386169) has the molecular formula C19H14F2N2O2 and a molecular weight of 340.33 g/mol. Its IUPAC name is 2,4-difluoro-N'-(2-naphthalen-1-ylacetyl)benzohydrazide.
| Compound Name | 2,4-difluoro-N'-(2-naphthalen-1-ylacetyl)benzohydrazide |
|---|---|
| PubChem CID | 42386169 |
| Molecular Formula | C19H14F2N2O2 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2,4-difluoro-N'-(2-naphthalen-1-ylacetyl)benzohydrazide |
| SMILES | O=C(Cc1cccc2ccccc12)NNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H14F2N2O2/c20-14-8-9-16(17(21)11-14)19(25)23-22-18(24)10-13-6-3-5-12-4-1-2-7-15(12)13/h1-9,11H,10H2,(H,22,24)(H,23,25) |
| InChIKey | WRMOTYBULUCEOK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|