C19H15ClN2O2 — CID 3396166
4-chloro-N'-(2-naphthalen-1-ylacetyl)benzohydrazide (PubChem CID 3396166) has the molecular formula C19H15ClN2O2 and a molecular weight of 338.79 g/mol. Its IUPAC name is 4-chloro-N'-(2-naphthalen-1-ylacetyl)benzohydrazide.
| Compound Name | 4-chloro-N'-(2-naphthalen-1-ylacetyl)benzohydrazide |
|---|---|
| PubChem CID | 3396166 |
| Molecular Formula | C19H15ClN2O2 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 4-chloro-N'-(2-naphthalen-1-ylacetyl)benzohydrazide |
| SMILES | O=C(Cc1cccc2ccccc12)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15ClN2O2/c20-16-10-8-14(9-11-16)19(24)22-21-18(23)12-15-6-3-5-13-4-1-2-7-17(13)15/h1-11H,12H2,(H,21,23)(H,22,24) |
| InChIKey | QHVPMTWYLWTPJF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|