C20H17ClN2O2 — CID 4936833
2-(4-chlorophenyl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide (PubChem CID 4936833) has the molecular formula C20H17ClN2O2 and a molecular weight of 352.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide.
| Compound Name | 2-(4-chlorophenyl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide |
|---|---|
| PubChem CID | 4936833 |
| Molecular Formula | C20H17ClN2O2 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-(4-chlorophenyl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NNC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C20H17ClN2O2/c21-17-10-8-14(9-11-17)12-19(24)22-23-20(25)13-16-6-3-5-15-4-1-2-7-18(15)16/h1-11H,12-13H2,(H,22,24)(H,23,25) |
| InChIKey | SNHXNTFKBIUXAS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|