C20H18ClN3OS — CID 12674110
1-(4-chloro-2-methylphenyl)-3-[(2-naphthalen-1-ylacetyl)amino]thiourea (PubChem CID 12674110) has the molecular formula C20H18ClN3OS and a molecular weight of 383.90 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenyl)-3-[(2-naphthalen-1-ylacetyl)amino]thiourea.
| Compound Name | 1-(4-chloro-2-methylphenyl)-3-[(2-naphthalen-1-ylacetyl)amino]thiourea |
|---|---|
| PubChem CID | 12674110 |
| Molecular Formula | C20H18ClN3OS |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 1-(4-chloro-2-methylphenyl)-3-[(2-naphthalen-1-ylacetyl)amino]thiourea |
| SMILES | Cc1cc(Cl)ccc1NC(=S)NNC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C20H18ClN3OS/c1-13-11-16(21)9-10-18(13)22-20(26)24-23-19(25)12-15-7-4-6-14-5-2-3-8-17(14)15/h2-11H,12H2,1H3,(H,23,25)(H2,22,24,26) |
| InChIKey | KNRNUSHKVHLVKX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|