C22H20ClNO3 — CID 53341147
(3S)-4-(4-chlorophenyl)-3-[(2-naphthalen-1-ylacetyl)amino]butanoic acid (PubChem CID 53341147) has the molecular formula C22H20ClNO3 and a molecular weight of 381.86 g/mol. Its IUPAC name is (3S)-4-(4-chlorophenyl)-3-[(2-naphthalen-1-ylacetyl)amino]butanoic acid.
| Compound Name | (3S)-4-(4-chlorophenyl)-3-[(2-naphthalen-1-ylacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 53341147 |
| Molecular Formula | C22H20ClNO3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (3S)-4-(4-chlorophenyl)-3-[(2-naphthalen-1-ylacetyl)amino]butanoic acid |
| SMILES | O=C(O)C[C@H](Cc1ccc(Cl)cc1)NC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C22H20ClNO3/c23-18-10-8-15(9-11-18)12-19(14-22(26)27)24-21(25)13-17-6-3-5-16-4-1-2-7-20(16)17/h1-11,19H,12-14H2,(H,24,25)(H,26,27)/t19-/m0/s1 |
| InChIKey | SQWKHIHVSTUIHI-IBGZPJMESA-N |
| XLogP | 4.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |