C22H21NO3 — CID 67360770
(3S)-4-naphthalen-2-yl-3-[(2-phenylacetyl)amino]butanoic acid (PubChem CID 67360770) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is (3S)-4-naphthalen-2-yl-3-[(2-phenylacetyl)amino]butanoic acid.
| Compound Name | (3S)-4-naphthalen-2-yl-3-[(2-phenylacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 67360770 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (3S)-4-naphthalen-2-yl-3-[(2-phenylacetyl)amino]butanoic acid |
| SMILES | O=C(O)C[C@H](Cc1ccc2ccccc2c1)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C22H21NO3/c24-21(14-16-6-2-1-3-7-16)23-20(15-22(25)26)13-17-10-11-18-8-4-5-9-19(18)12-17/h1-12,20H,13-15H2,(H,23,24)(H,25,26)/t20-/m0/s1 |
| InChIKey | UTASGEZSTLUPOR-FQEVSTJZSA-N |
| XLogP | 3.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |