C19H20ClNO3 — CID 67362285
4-(3-chlorophenyl)-3-[[2-(3-methylphenyl)acetyl]amino]butanoic acid (PubChem CID 67362285) has the molecular formula C19H20ClNO3 and a molecular weight of 345.83 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-3-[[2-(3-methylphenyl)acetyl]amino]butanoic acid.
| Compound Name | 4-(3-chlorophenyl)-3-[[2-(3-methylphenyl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 67362285 |
| Molecular Formula | C19H20ClNO3 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 4-(3-chlorophenyl)-3-[[2-(3-methylphenyl)acetyl]amino]butanoic acid |
| SMILES | Cc1cccc(CC(=O)NC(CC(=O)O)Cc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C19H20ClNO3/c1-13-4-2-5-14(8-13)11-18(22)21-17(12-19(23)24)10-15-6-3-7-16(20)9-15/h2-9,17H,10-12H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | OIFJWATWJUMTOY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |