C19H17ClN2O3 — CID 67360113
3-[[2-(3-chlorophenyl)acetyl]amino]-4-(4-cyanophenyl)butanoic acid (PubChem CID 67360113) has the molecular formula C19H17ClN2O3 and a molecular weight of 356.81 g/mol. Its IUPAC name is 3-[[2-(3-chlorophenyl)acetyl]amino]-4-(4-cyanophenyl)butanoic acid.
| Compound Name | 3-[[2-(3-chlorophenyl)acetyl]amino]-4-(4-cyanophenyl)butanoic acid |
|---|---|
| PubChem CID | 67360113 |
| Molecular Formula | C19H17ClN2O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 3-[[2-(3-chlorophenyl)acetyl]amino]-4-(4-cyanophenyl)butanoic acid |
| SMILES | N#Cc1ccc(CC(CC(=O)O)NC(=O)Cc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H17ClN2O3/c20-16-3-1-2-15(8-16)10-18(23)22-17(11-19(24)25)9-13-4-6-14(12-21)7-5-13/h1-8,17H,9-11H2,(H,22,23)(H,24,25) |
| InChIKey | MGLVSUGOADZJFS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |