C19H16Cl2N2O3 — CID 67361893
(3S)-4-(4-cyanophenyl)-3-[[2-(3,4-dichlorophenyl)acetyl]amino]butanoic acid (PubChem CID 67361893) has the molecular formula C19H16Cl2N2O3 and a molecular weight of 391.25 g/mol. Its IUPAC name is (3S)-4-(4-cyanophenyl)-3-[[2-(3,4-dichlorophenyl)acetyl]amino]butanoic acid.
| Compound Name | (3S)-4-(4-cyanophenyl)-3-[[2-(3,4-dichlorophenyl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 67361893 |
| Molecular Formula | C19H16Cl2N2O3 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | (3S)-4-(4-cyanophenyl)-3-[[2-(3,4-dichlorophenyl)acetyl]amino]butanoic acid |
| SMILES | N#Cc1ccc(C[C@@H](CC(=O)O)NC(=O)Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H16Cl2N2O3/c20-16-6-5-14(8-17(16)21)9-18(24)23-15(10-19(25)26)7-12-1-3-13(11-22)4-2-12/h1-6,8,15H,7,9-10H2,(H,23,24)(H,25,26)/t15-/m0/s1 |
| InChIKey | GAPHSABXWWBISN-HNNXBMFYSA-N |
| XLogP | 3.61 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |