C11H13N3O2 — CID 129188135
[(2R)-1-amino-3-(4-cyanophenyl)propan-2-yl]carbamic acid (PubChem CID 129188135) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is [(2R)-1-amino-3-(4-cyanophenyl)propan-2-yl]carbamic acid.
| Compound Name | [(2R)-1-amino-3-(4-cyanophenyl)propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 129188135 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | [(2R)-1-amino-3-(4-cyanophenyl)propan-2-yl]carbamic acid |
| SMILES | N#Cc1ccc(C[C@H](CN)NC(=O)O)cc1 |
| InChI | InChI=1S/C11H13N3O2/c12-6-9-3-1-8(2-4-9)5-10(7-13)14-11(15)16/h1-4,10,14H,5,7,13H2,(H,15,16)/t10-/m1/s1 |
| InChIKey | HCUGOYDQGRPPHT-SNVBAGLBSA-N |
| XLogP | 0.70 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |