C19H28N4O2 — CID 139301249
[1-(4-cyanophenyl)-4-[(1-methylpiperidin-4-yl)methylamino]butan-2-yl]carbamic acid (PubChem CID 139301249) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is [1-(4-cyanophenyl)-4-[(1-methylpiperidin-4-yl)methylamino]butan-2-yl]carbamic acid.
| Compound Name | [1-(4-cyanophenyl)-4-[(1-methylpiperidin-4-yl)methylamino]butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 139301249 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | [1-(4-cyanophenyl)-4-[(1-methylpiperidin-4-yl)methylamino]butan-2-yl]carbamic acid |
| SMILES | CN1CCC(CNCCC(Cc2ccc(C#N)cc2)NC(=O)O)CC1 |
| InChI | InChI=1S/C19H28N4O2/c1-23-10-7-17(8-11-23)14-21-9-6-18(22-19(24)25)12-15-2-4-16(13-20)5-3-15/h2-5,17-18,21-22H,6-12,14H2,1H3,(H,24,25) |
| InChIKey | YJTZUZGYTQIRCZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|