C20H29N3O3 — CID 129196903
tert-butyl N-[(2R)-1-(4-cyanophenyl)-4-morpholin-4-ylbutan-2-yl]carbamate (PubChem CID 129196903) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(4-cyanophenyl)-4-morpholin-4-ylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(4-cyanophenyl)-4-morpholin-4-ylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 129196903 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | tert-butyl N-[(2R)-1-(4-cyanophenyl)-4-morpholin-4-ylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCN1CCOCC1)Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H29N3O3/c1-20(2,3)26-19(24)22-18(8-9-23-10-12-25-13-11-23)14-16-4-6-17(15-21)7-5-16/h4-7,18H,8-14H2,1-3H3,(H,22,24)/t18-/m0/s1 |
| InChIKey | XWDLIUNQTKPMBY-SFHVURJKSA-N |
| XLogP | 2.72 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |