C27H37N3O4 — CID 68753649
tert-butyl N-[1,2-bis(4-morpholin-4-ylphenyl)ethyl]carbamate (PubChem CID 68753649) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is tert-butyl N-[1,2-bis(4-morpholin-4-ylphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1,2-bis(4-morpholin-4-ylphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 68753649 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | tert-butyl N-[1,2-bis(4-morpholin-4-ylphenyl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(N2CCOCC2)cc1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C27H37N3O4/c1-27(2,3)34-26(31)28-25(22-6-10-24(11-7-22)30-14-18-33-19-15-30)20-21-4-8-23(9-5-21)29-12-16-32-17-13-29/h4-11,25H,12-20H2,1-3H3,(H,28,31) |
| InChIKey | AWOUPMLDGLPTFQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|