C16H22N2O4 — CID 75176217
methyl (2S)-2-acetamido-3-(4-morpholin-4-ylphenyl)propanoate (PubChem CID 75176217) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is methyl (2S)-2-acetamido-3-(4-morpholin-4-ylphenyl)propanoate.
| Compound Name | methyl (2S)-2-acetamido-3-(4-morpholin-4-ylphenyl)propanoate |
|---|---|
| PubChem CID | 75176217 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | methyl (2S)-2-acetamido-3-(4-morpholin-4-ylphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(N2CCOCC2)cc1)NC(C)=O |
| InChI | InChI=1S/C16H22N2O4/c1-12(19)17-15(16(20)21-2)11-13-3-5-14(6-4-13)18-7-9-22-10-8-18/h3-6,15H,7-11H2,1-2H3,(H,17,19)/t15-/m0/s1 |
| InChIKey | CASYLQXBOISREB-HNNXBMFYSA-N |
| XLogP | 0.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|