C20H22N2O2 — CID 102141553
tert-butyl N-[(1R)-1-(4-cyanophenyl)-2-phenylethyl]carbamate (PubChem CID 102141553) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(4-cyanophenyl)-2-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(4-cyanophenyl)-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 102141553 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | tert-butyl N-[(1R)-1-(4-cyanophenyl)-2-phenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccccc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H22N2O2/c1-20(2,3)24-19(23)22-18(13-15-7-5-4-6-8-15)17-11-9-16(14-21)10-12-17/h4-12,18H,13H2,1-3H3,(H,22,23)/t18-/m1/s1 |
| InChIKey | HJKACVYCPPZLDR-GOSISDBHSA-N |
| XLogP | 4.37 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |