C16H17NO2 — CID 139785732
methyl N-(1,2-diphenylethyl)carbamate (PubChem CID 139785732) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is methyl N-(1,2-diphenylethyl)carbamate.
| Compound Name | methyl N-(1,2-diphenylethyl)carbamate |
|---|---|
| PubChem CID | 139785732 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | methyl N-(1,2-diphenylethyl)carbamate |
| SMILES | COC(=O)NC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c1-19-16(18)17-15(14-10-6-3-7-11-14)12-13-8-4-2-5-9-13/h2-11,15H,12H2,1H3,(H,17,18) |
| InChIKey | ALJGTGQUHPBNPW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |