C11H15NO3 — CID 11085058
methyl N-(1-methoxy-2-phenylethyl)carbamate (PubChem CID 11085058) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is methyl N-(1-methoxy-2-phenylethyl)carbamate.
| Compound Name | methyl N-(1-methoxy-2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 11085058 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | methyl N-(1-methoxy-2-phenylethyl)carbamate |
| SMILES | COC(=O)NC(Cc1ccccc1)OC |
| InChI | InChI=1S/C11H15NO3/c1-14-10(12-11(13)15-2)8-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3,(H,12,13) |
| InChIKey | HRRNJTREZHCZPM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|