C14H17NO2 — CID 139471015
methyl N-[(2S)-1-phenylhex-5-yn-2-yl]carbamate (PubChem CID 139471015) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is methyl N-[(2S)-1-phenylhex-5-yn-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-phenylhex-5-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 139471015 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | methyl N-[(2S)-1-phenylhex-5-yn-2-yl]carbamate |
| SMILES | C#CCC[C@@H](Cc1ccccc1)NC(=O)OC |
| InChI | InChI=1S/C14H17NO2/c1-3-4-10-13(15-14(16)17-2)11-12-8-6-5-7-9-12/h1,5-9,13H,4,10-11H2,2H3,(H,15,16)/t13-/m0/s1 |
| InChIKey | HXCIIWOYQDKKRS-ZDUSSCGKSA-N |
| XLogP | 2.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|