C14H17NO3 — CID 90853214
methyl N-(4-oxo-1-phenylhex-5-en-2-yl)carbamate (PubChem CID 90853214) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is methyl N-(4-oxo-1-phenylhex-5-en-2-yl)carbamate.
| Compound Name | methyl N-(4-oxo-1-phenylhex-5-en-2-yl)carbamate |
|---|---|
| PubChem CID | 90853214 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | methyl N-(4-oxo-1-phenylhex-5-en-2-yl)carbamate |
| SMILES | C=CC(=O)CC(Cc1ccccc1)NC(=O)OC |
| InChI | InChI=1S/C14H17NO3/c1-3-13(16)10-12(15-14(17)18-2)9-11-7-5-4-6-8-11/h3-8,12H,1,9-10H2,2H3,(H,15,17) |
| InChIKey | PYLSBJVMACUTDA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|