C18H18N2O — CID 36512732
1-[(1S)-1,2-diphenylethyl]-3-prop-2-ynylurea (PubChem CID 36512732) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-[(1S)-1,2-diphenylethyl]-3-prop-2-ynylurea.
| Compound Name | 1-[(1S)-1,2-diphenylethyl]-3-prop-2-ynylurea |
|---|---|
| PubChem CID | 36512732 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 1-[(1S)-1,2-diphenylethyl]-3-prop-2-ynylurea |
| SMILES | C#CCNC(=O)N[C@@H](Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O/c1-2-13-19-18(21)20-17(16-11-7-4-8-12-16)14-15-9-5-3-6-10-15/h1,3-12,17H,13-14H2,(H2,19,20,21)/t17-/m0/s1 |
| InChIKey | UVAKGFXXGBVEOK-KRWDZBQOSA-N |
| XLogP | 2.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|