C24H26N2O3 — CID 55589771
1-(1,2-diphenylethyl)-3-[2-(2-methoxyphenoxy)ethyl]urea (PubChem CID 55589771) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-(1,2-diphenylethyl)-3-[2-(2-methoxyphenoxy)ethyl]urea.
| Compound Name | 1-(1,2-diphenylethyl)-3-[2-(2-methoxyphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 55589771 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-(1,2-diphenylethyl)-3-[2-(2-methoxyphenoxy)ethyl]urea |
| SMILES | COc1ccccc1OCCNC(=O)NC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26N2O3/c1-28-22-14-8-9-15-23(22)29-17-16-25-24(27)26-21(20-12-6-3-7-13-20)18-19-10-4-2-5-11-19/h2-15,21H,16-18H2,1H3,(H2,25,26,27) |
| InChIKey | ZNHMJVWLOQRGGA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|