C19H24N2O5 — CID 55750339
1-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-[2-(2-methoxyphenoxy)ethyl]urea (PubChem CID 55750339) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-[2-(2-methoxyphenoxy)ethyl]urea.
| Compound Name | 1-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-[2-(2-methoxyphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 55750339 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-[2-(2-methoxyphenoxy)ethyl]urea |
| SMILES | COc1ccc(C(O)CNC(=O)NCCOc2ccccc2OC)cc1 |
| InChI | InChI=1S/C19H24N2O5/c1-24-15-9-7-14(8-10-15)16(22)13-21-19(23)20-11-12-26-18-6-4-3-5-17(18)25-2/h3-10,16,22H,11-13H2,1-2H3,(H2,20,21,23) |
| InChIKey | HSDJTXMNDCVKFN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|