C10H14N2O3 — CID 137321016
[2-hydroxy-2-(4-methoxyphenyl)ethyl]urea (PubChem CID 137321016) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is [2-hydroxy-2-(4-methoxyphenyl)ethyl]urea.
| Compound Name | [2-hydroxy-2-(4-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 137321016 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | [2-hydroxy-2-(4-methoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(C(O)CNC(N)=O)cc1 |
| InChI | InChI=1S/C10H14N2O3/c1-15-8-4-2-7(3-5-8)9(13)6-12-10(11)14/h2-5,9,13H,6H2,1H3,(H3,11,12,14) |
| InChIKey | YJEGINBZKNFLCA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |