C15H19N3O3 — CID 122163510
tert-butyl N-[1-(1,3,4-oxadiazol-2-yl)-2-phenylethyl]carbamate (PubChem CID 122163510) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is tert-butyl N-[1-(1,3,4-oxadiazol-2-yl)-2-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[1-(1,3,4-oxadiazol-2-yl)-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 122163510 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | tert-butyl N-[1-(1,3,4-oxadiazol-2-yl)-2-phenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)c1nnco1 |
| InChI | InChI=1S/C15H19N3O3/c1-15(2,3)21-14(19)17-12(13-18-16-10-20-13)9-11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3,(H,17,19) |
| InChIKey | SPXJDZFYWKXKHP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |