C23H25N3O2 — CID 101394448
tert-butyl N-[(1S)-2-phenyl-1-(2-phenylpyrimidin-4-yl)ethyl]carbamate (PubChem CID 101394448) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-phenyl-1-(2-phenylpyrimidin-4-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-phenyl-1-(2-phenylpyrimidin-4-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 101394448 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | tert-butyl N-[(1S)-2-phenyl-1-(2-phenylpyrimidin-4-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)c1ccnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H25N3O2/c1-23(2,3)28-22(27)26-20(16-17-10-6-4-7-11-17)19-14-15-24-21(25-19)18-12-8-5-9-13-18/h4-15,20H,16H2,1-3H3,(H,26,27)/t20-/m0/s1 |
| InChIKey | LPZKSSJSURBMOF-FQEVSTJZSA-N |
| XLogP | 4.95 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |