C24H25N3O2 — CID 10091617
tert-butyl N-[2-phenyl-1-(9H-pyrido[3,4-b]indol-1-yl)ethyl]carbamate (PubChem CID 10091617) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is tert-butyl N-[2-phenyl-1-(9H-pyrido[3,4-b]indol-1-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-phenyl-1-(9H-pyrido[3,4-b]indol-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 10091617 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | tert-butyl N-[2-phenyl-1-(9H-pyrido[3,4-b]indol-1-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)c1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C24H25N3O2/c1-24(2,3)29-23(28)27-20(15-16-9-5-4-6-10-16)22-21-18(13-14-25-22)17-11-7-8-12-19(17)26-21/h4-14,20,26H,15H2,1-3H3,(H,27,28) |
| InChIKey | CIDFOJRTSUFWBW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |