C19H22Cl2N2O2 — CID 121290621
tert-butyl N-[(1S)-1-[5-chloro-3-(chloromethyl)-2-pyridinyl]-2-phenylethyl]carbamate (PubChem CID 121290621) has the molecular formula C19H22Cl2N2O2 and a molecular weight of 381.30 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[5-chloro-3-(chloromethyl)-2-pyridinyl]-2-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[5-chloro-3-(chloromethyl)-2-pyridinyl]-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 121290621 |
| Molecular Formula | C19H22Cl2N2O2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | tert-butyl N-[(1S)-1-[5-chloro-3-(chloromethyl)-2-pyridinyl]-2-phenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)c1ncc(Cl)cc1CCl |
| InChI | InChI=1S/C19H22Cl2N2O2/c1-19(2,3)25-18(24)23-16(9-13-7-5-4-6-8-13)17-14(11-20)10-15(21)12-22-17/h4-8,10,12,16H,9,11H2,1-3H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | SHTJTMHANOCARV-INIZCTEOSA-N |
| XLogP | 5.28 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|