C17H19F3N2O5S2 — CID 56954466
[2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethyl]-1,3-thiazol-5-yl] trifluoromethanesulfonate (PubChem CID 56954466) has the molecular formula C17H19F3N2O5S2 and a molecular weight of 452.48 g/mol. Its IUPAC name is [2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethyl]-1,3-thiazol-5-yl] trifluoromethanesulfonate.
| Compound Name | [2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethyl]-1,3-thiazol-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 56954466 |
| Molecular Formula | C17H19F3N2O5S2 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | [2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethyl]-1,3-thiazol-5-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)c1ncc(OS(=O)(=O)C(F)(F)F)s1 |
| InChI | InChI=1S/C17H19F3N2O5S2/c1-16(2,3)26-15(23)22-12(9-11-7-5-4-6-8-11)14-21-10-13(28-14)27-29(24,25)17(18,19)20/h4-8,10,12H,9H2,1-3H3,(H,22,23)/t12-/m0/s1 |
| InChIKey | MNLWPUFLEKLETN-LBPRGKRZSA-N |
| XLogP | 4.18 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|