C19H26F3NO7S — CID 87446314
tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate (PubChem CID 87446314) has the molecular formula C19H26F3NO7S and a molecular weight of 469.48 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate.
| Compound Name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 87446314 |
| Molecular Formula | C19H26F3NO7S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26F3NO7S/c1-17(2,3)28-15(24)14(23-16(25)29-18(4,5)6)11-12-7-9-13(10-8-12)30-31(26,27)19(20,21)22/h7-10,14H,11H2,1-6H3,(H,23,25)/t14-/m0/s1 |
| InChIKey | VLUAMVPXYBIDAU-AWEZNQCLSA-N |
| XLogP | 3.69 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|