C17H21Cl2N2O2S- — CID 23327115
tert-butyl N-[(1R)-1-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-phenylethyl]carbamate chloride (PubChem CID 23327115) has the molecular formula C17H21Cl2N2O2S- and a molecular weight of 388.34 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-phenylethyl]carbamate chloride.
| Compound Name | tert-butyl N-[(1R)-1-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-phenylethyl]carbamate chloride |
|---|---|
| PubChem CID | 23327115 |
| Molecular Formula | C17H21Cl2N2O2S- |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | tert-butyl N-[(1R)-1-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-phenylethyl]carbamate chloride |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccccc1)c1nc(CCl)cs1.[Cl-] |
| InChI | InChI=1S/C17H21ClN2O2S.ClH/c1-17(2,3)22-16(21)20-14(9-12-7-5-4-6-8-12)15-19-13(10-18)11-23-15;/h4-8,11,14H,9-10H2,1-3H3,(H,20,21);1H/p-1/t14-;/m1./s1 |
| InChIKey | DIGMMVHAFKGRNS-PFEQFJNWSA-M |
| XLogP | 1.69 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|