C14H23Cl2N2O2S- — CID 22829472
tert-butyl N-[(1S,2S)-1-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-methylbutyl]carbamate chloride (PubChem CID 22829472) has the molecular formula C14H23Cl2N2O2S- and a molecular weight of 354.32 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-1-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-methylbutyl]carbamate chloride.
| Compound Name | tert-butyl N-[(1S,2S)-1-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-methylbutyl]carbamate chloride |
|---|---|
| PubChem CID | 22829472 |
| Molecular Formula | C14H23Cl2N2O2S- |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | tert-butyl N-[(1S,2S)-1-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-methylbutyl]carbamate chloride |
| SMILES | CC[C@H](C)[C@H](NC(=O)OC(C)(C)C)c1nc(CCl)cs1.[Cl-] |
| InChI | InChI=1S/C14H23ClN2O2S.ClH/c1-6-9(2)11(12-16-10(7-15)8-20-12)17-13(18)19-14(3,4)5;/h8-9,11H,6-7H2,1-5H3,(H,17,18);1H/p-1/t9-,11-;/m0./s1 |
| InChIKey | IRFQNDBISNEJAQ-ROLPUNSJSA-M |
| XLogP | 1.50 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|