C19H35N5O2S — CID 111886249
tert-butyl N-[3-[[ethylamino-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethylamino]methylidene]amino]propyl]carbamate (PubChem CID 111886249) has the molecular formula C19H35N5O2S and a molecular weight of 397.59 g/mol. Its IUPAC name is tert-butyl N-[3-[[ethylamino-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethylamino]methylidene]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[ethylamino-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethylamino]methylidene]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111886249 |
| Molecular Formula | C19H35N5O2S |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | tert-butyl N-[3-[[ethylamino-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethylamino]methylidene]amino]propyl]carbamate |
| SMILES | CCN/C(=N\CCCNC(=O)OC(C)(C)C)NCCc1csc(C(C)C)n1 |
| InChI | InChI=1S/C19H35N5O2S/c1-7-20-17(21-10-8-11-23-18(25)26-19(4,5)6)22-12-9-15-13-27-16(24-15)14(2)3/h13-14H,7-12H2,1-6H3,(H,23,25)(H2,20,21,22) |
| InChIKey | SKUJSXAMMUMDQZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|