C17H32IN5O2S — CID 111886654
tert-butyl N-[3-[[ethylamino-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]methylidene]amino]propyl]carbamate;hydroiodide (PubChem CID 111886654) has the molecular formula C17H32IN5O2S and a molecular weight of 497.45 g/mol. Its IUPAC name is tert-butyl N-[3-[[ethylamino-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]methylidene]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[ethylamino-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]methylidene]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111886654 |
| Molecular Formula | C17H32IN5O2S |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | tert-butyl N-[3-[[ethylamino-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]methylidene]amino]propyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCCNC(=O)OC(C)(C)C)NCCc1csc(C)n1.I |
| InChI | InChI=1S/C17H31N5O2S.HI/c1-6-18-15(20-11-8-14-12-25-13(2)22-14)19-9-7-10-21-16(23)24-17(3,4)5;/h12H,6-11H2,1-5H3,(H,21,23)(H2,18,19,20);1H |
| InChIKey | MOWRRISVSHLOHA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|