C19H36IN5O2S — CID 109396357
tert-butyl N-[2-[[N-ethyl-N'-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]ethyl]-N-propylcarbamate;hydroiodide (PubChem CID 109396357) has the molecular formula C19H36IN5O2S and a molecular weight of 525.50 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]ethyl]-N-propylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]ethyl]-N-propylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 109396357 |
| Molecular Formula | C19H36IN5O2S |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]ethyl]-N-propylcarbamate;hydroiodide |
| SMILES | CCCN(CCN/C(=N/CCc1csc(C)n1)NCC)C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C19H35N5O2S.HI/c1-7-12-24(18(25)26-19(4,5)6)13-11-22-17(20-8-2)21-10-9-16-14-27-15(3)23-16;/h14H,7-13H2,1-6H3,(H2,20,21,22);1H |
| InChIKey | XOBMHIKWAUMJKZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|