C16H35IN4O3 — CID 111894418
tert-butyl N-[2-[[N'-(2-ethoxyethyl)-N-ethylcarbamimidoyl]amino]ethyl]-N-ethylcarbamate;hydroiodide (PubChem CID 111894418) has the molecular formula C16H35IN4O3 and a molecular weight of 458.39 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-(2-ethoxyethyl)-N-ethylcarbamimidoyl]amino]ethyl]-N-ethylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-(2-ethoxyethyl)-N-ethylcarbamimidoyl]amino]ethyl]-N-ethylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 111894418 |
| Molecular Formula | C16H35IN4O3 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | tert-butyl N-[2-[[N'-(2-ethoxyethyl)-N-ethylcarbamimidoyl]amino]ethyl]-N-ethylcarbamate;hydroiodide |
| SMILES | CCN/C(=N\CCOCC)NCCN(CC)C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C16H34N4O3.HI/c1-7-17-14(19-11-13-22-9-3)18-10-12-20(8-2)15(21)23-16(4,5)6;/h7-13H2,1-6H3,(H2,17,18,19);1H |
| InChIKey | XYNNKSCDYVIIKK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|