C19H37IN4OS — CID 111715924
2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111715924) has the molecular formula C19H37IN4OS and a molecular weight of 496.50 g/mol. Its IUPAC name is 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111715924 |
| Molecular Formula | C19H37IN4OS |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)NCCc1csc(C(C)C)n1.I |
| InChI | InChI=1S/C19H36N4OS.HI/c1-6-19(7-2,10-12-24)14-22-18(20-8-3)21-11-9-16-13-25-17(23-16)15(4)5;/h13,15,24H,6-12,14H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | VPZHHILCXMRLMX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|