C22H35IN4O — CID 111716507
2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-(2-quinolin-8-ylethyl)guanidine;hydroiodide (PubChem CID 111716507) has the molecular formula C22H35IN4O and a molecular weight of 498.45 g/mol. Its IUPAC name is 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-(2-quinolin-8-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-(2-quinolin-8-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111716507 |
| Molecular Formula | C22H35IN4O |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-(2-quinolin-8-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)NCCc1cccc2cccnc12.I |
| InChI | InChI=1S/C22H34N4O.HI/c1-4-22(5-2,13-16-27)17-26-21(23-6-3)25-15-12-19-10-7-9-18-11-8-14-24-20(18)19;/h7-11,14,27H,4-6,12-13,15-17H2,1-3H3,(H2,23,25,26);1H |
| InChIKey | BWBSCTCEBBIFPJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|