C20H26IN5S — CID 111933937
1-ethyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-(2-quinolin-8-ylethyl)guanidine;hydroiodide (PubChem CID 111933937) has the molecular formula C20H26IN5S and a molecular weight of 495.43 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-(2-quinolin-8-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-(2-quinolin-8-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111933937 |
| Molecular Formula | C20H26IN5S |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | 1-ethyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-(2-quinolin-8-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1csc(C)n1)NCCc1cccc2cccnc12.I |
| InChI | InChI=1S/C20H25N5S.HI/c1-3-21-20(24-13-10-18-14-26-15(2)25-18)23-12-9-17-7-4-6-16-8-5-11-22-19(16)17;/h4-8,11,14H,3,9-10,12-13H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | DVFYKSRQVKLOBD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|