C20H26IN5S — CID 109421893
3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(2-quinolin-8-ylethyl)guanidine;hydroiodide (PubChem CID 109421893) has the molecular formula C20H26IN5S and a molecular weight of 495.43 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(2-quinolin-8-ylethyl)guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(2-quinolin-8-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109421893 |
| Molecular Formula | C20H26IN5S |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(2-quinolin-8-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1cccc2cccnc12)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C20H25N5S.HI/c1-4-21-20(25(3)13-18-14-26-15(2)24-18)23-12-10-17-8-5-7-16-9-6-11-22-19(16)17;/h5-9,11,14H,4,10,12-13H2,1-3H3,(H,21,23);1H |
| InChIKey | RRMVOKMTBGXFAI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|