C20H27N5S — CID 109423712
3-ethyl-1-methyl-2-[2-(4-methyl-1H-indol-3-yl)ethyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109423712) has the molecular formula C20H27N5S and a molecular weight of 369.54 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[2-(4-methyl-1H-indol-3-yl)ethyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-2-[2-(4-methyl-1H-indol-3-yl)ethyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109423712 |
| Molecular Formula | C20H27N5S |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 3-ethyl-1-methyl-2-[2-(4-methyl-1H-indol-3-yl)ethyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CCc1c[nH]c2cccc(C)c12)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C20H27N5S/c1-5-21-20(25(4)12-17-13-26-15(3)24-17)22-10-9-16-11-23-18-8-6-7-14(2)19(16)18/h6-8,11,13,23H,5,9-10,12H2,1-4H3,(H,21,22) |
| InChIKey | MKXWLKHKEFYRQN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|