C19H28IN5OS — CID 109424703
3-[2-[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]ethyl]-N-methylbenzamide;hydroiodide (PubChem CID 109424703) has the molecular formula C19H28IN5OS and a molecular weight of 501.44 g/mol. Its IUPAC name is 3-[2-[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]ethyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[2-[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]ethyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 109424703 |
| Molecular Formula | C19H28IN5OS |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 3-[2-[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]ethyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1cccc(C(=O)NC)c1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C19H27N5OS.HI/c1-5-21-19(24(4)12-17-13-26-14(2)23-17)22-10-9-15-7-6-8-16(11-15)18(25)20-3;/h6-8,11,13H,5,9-10,12H2,1-4H3,(H,20,25)(H,21,22);1H |
| InChIKey | KSGXVGSJEPHGDQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|