C21H33N5S — CID 109423624
2-[3-[benzyl(methyl)amino]butyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109423624) has the molecular formula C21H33N5S and a molecular weight of 387.60 g/mol. Its IUPAC name is 2-[3-[benzyl(methyl)amino]butyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 2-[3-[benzyl(methyl)amino]butyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109423624 |
| Molecular Formula | C21H33N5S |
| Molecular Weight | 387.60 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 2-[3-[benzyl(methyl)amino]butyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CCC(C)N(C)Cc1ccccc1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C21H33N5S/c1-6-22-21(26(5)15-20-16-27-18(3)24-20)23-13-12-17(2)25(4)14-19-10-8-7-9-11-19/h7-11,16-17H,6,12-15H2,1-5H3,(H,22,23) |
| InChIKey | ZIBZNKBVRUHAGK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.60 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|