C21H27N5S2 — CID 109421106
3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methyl]guanidine (PubChem CID 109421106) has the molecular formula C21H27N5S2 and a molecular weight of 413.62 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109421106 |
| Molecular Formula | C21H27N5S2 |
| Molecular Weight | 413.62 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1csc(CCc2ccccc2)n1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C21H27N5S2/c1-4-22-21(26(3)13-19-15-27-16(2)24-19)23-12-18-14-28-20(25-18)11-10-17-8-6-5-7-9-17/h5-9,14-15H,4,10-13H2,1-3H3,(H,22,23) |
| InChIKey | UQXCTXWHXIXMST-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|