C21H32IN5OS — CID 109425385
N,N-diethyl-4-[[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 109425385) has the molecular formula C21H32IN5OS and a molecular weight of 529.49 g/mol. Its IUPAC name is N,N-diethyl-4-[[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N,N-diethyl-4-[[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 109425385 |
| Molecular Formula | C21H32IN5OS |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | N,N-diethyl-4-[[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(CC)CC)cc1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C21H31N5OS.HI/c1-6-22-21(25(5)14-19-15-28-16(4)24-19)23-13-17-9-11-18(12-10-17)20(27)26(7-2)8-3;/h9-12,15H,6-8,13-14H2,1-5H3,(H,22,23);1H |
| InChIKey | YBMAVCYPWRNSIB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|