C20H32IN5O2S2 — CID 109422027
3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109422027) has the molecular formula C20H32IN5O2S2 and a molecular weight of 565.55 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109422027 |
| Molecular Formula | C20H32IN5O2S2 |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 565.10 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CS(=O)(=O)NC(C)C)cc1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C20H31N5O2S2.HI/c1-6-21-20(25(5)12-19-13-28-16(4)23-19)22-11-17-7-9-18(10-8-17)14-29(26,27)24-15(2)3;/h7-10,13,15,24H,6,11-12,14H2,1-5H3,(H,21,22);1H |
| InChIKey | IOTPBBHZHMGJFT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|