C23H37IN6S — CID 109425345
3-ethyl-1-methyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109425345) has the molecular formula C23H37IN6S and a molecular weight of 556.56 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109425345 |
| Molecular Formula | C23H37IN6S |
| Molecular Weight | 556.56 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 3-ethyl-1-methyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCN(C)CC2)cc1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C23H36N6S.HI/c1-5-24-23(28(4)17-22-18-30-19(2)26-22)25-15-20-7-9-21(10-8-20)16-29-12-6-11-27(3)13-14-29;/h7-10,18H,5-6,11-17H2,1-4H3,(H,24,25);1H |
| InChIKey | DJBDZSFTHNVKJL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|