C23H32N4O — CID 110950330
4-[[[[benzyl(methyl)amino]-(ethylamino)methylidene]amino]methyl]-N,N-diethylbenzamide (PubChem CID 110950330) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is 4-[[[[benzyl(methyl)amino]-(ethylamino)methylidene]amino]methyl]-N,N-diethylbenzamide.
| Compound Name | 4-[[[[benzyl(methyl)amino]-(ethylamino)methylidene]amino]methyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 110950330 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 4-[[[[benzyl(methyl)amino]-(ethylamino)methylidene]amino]methyl]-N,N-diethylbenzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(CC)CC)cc1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C23H32N4O/c1-5-24-23(26(4)18-20-11-9-8-10-12-20)25-17-19-13-15-21(16-14-19)22(28)27(6-2)7-3/h8-16H,5-7,17-18H2,1-4H3,(H,24,25) |
| InChIKey | OQWHISVPXNAJJH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|